C24H17ClFNO5 — CID 108582714
(4E)-1-(3-chlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108582714) has the molecular formula C24H17ClFNO5 and a molecular weight of 453.85 g/mol. Its IUPAC name is (4E)-1-(3-chlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108582714 |
| Molecular Formula | C24H17ClFNO5 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (4E)-1-(3-chlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(F)cc1/C(O)=C1\C(=O)C(=O)N(c2cccc(Cl)c2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H17ClFNO5/c1-32-19-10-7-15(26)12-18(19)22(29)20-21(13-5-8-17(28)9-6-13)27(24(31)23(20)30)16-4-2-3-14(25)11-16/h2-12,21,28-29H,1H3/b22-20+ |
| InChIKey | HMMIKWOHOCSZAS-LSDHQDQOSA-N |
| XLogP | 4.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|