C24H15FN2O4 — CID 108583021
4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108583021) has the molecular formula C24H15FN2O4 and a molecular weight of 414.39 g/mol. Its IUPAC name is 4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108583021 |
| Molecular Formula | C24H15FN2O4 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(F)cc3)C2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H15FN2O4/c25-17-7-3-16(4-8-17)22(29)20-21(15-5-11-19(28)12-6-15)27(24(31)23(20)30)18-9-1-14(13-26)2-10-18/h1-12,21,28-29H/b22-20+ |
| InChIKey | GLAYTXSPDWDTFF-LSDHQDQOSA-N |
| XLogP | 4.03 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|