C10H18BrNO2 — CID 10858329
ethyl (3S,4S)-1-methyl-1-azoniabicyclo[2.2.1]heptane-3-carboxylate bromide (PubChem CID 10858329) has the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. Its IUPAC name is ethyl (3S,4S)-1-methyl-1-azoniabicyclo[2.2.1]heptane-3-carboxylate bromide.
| Compound Name | ethyl (3S,4S)-1-methyl-1-azoniabicyclo[2.2.1]heptane-3-carboxylate bromide |
|---|---|
| PubChem CID | 10858329 |
| Molecular Formula | C10H18BrNO2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | ethyl (3S,4S)-1-methyl-1-azoniabicyclo[2.2.1]heptane-3-carboxylate bromide |
| SMILES | CCOC(=O)[C@@H]1C[N+]2(C)CC[C@@H]1C2.[Br-] |
| InChI | InChI=1S/C10H18NO2.BrH/c1-3-13-10(12)9-7-11(2)5-4-8(9)6-11;/h8-9H,3-7H2,1-2H3;1H/q+1;/p-1/t8-,9-,11?;/m1./s1 |
| InChIKey | DEOCVVFSIPWIPI-FRGPAYMJSA-M |
| XLogP | -2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|