C22H16ClNO4 — CID 108584429
1-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-2H-pyrrol-5-one (PubChem CID 108584429) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108584429 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-2H-pyrrol-5-one |
| SMILES | Cc1cccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H16ClNO4/c1-13-4-2-5-14(12-13)19-18(20(25)17-6-3-11-28-17)21(26)22(27)24(19)16-9-7-15(23)8-10-16/h2-12,19,26H,1H3 |
| InChIKey | RBXBVZHKKNOWOR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |