C15H12N2O3 — CID 10858475
(3,6-dimethyl-4-oxido-[1,2]oxazolo[4,5-b]pyridin-4-ium-5-yl)-phenylmethanone (PubChem CID 10858475) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is (3,6-dimethyl-4-oxido-[1,2]oxazolo[4,5-b]pyridin-4-ium-5-yl)-phenylmethanone.
| Compound Name | (3,6-dimethyl-4-oxido-[1,2]oxazolo[4,5-b]pyridin-4-ium-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 10858475 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (3,6-dimethyl-4-oxido-[1,2]oxazolo[4,5-b]pyridin-4-ium-5-yl)-phenylmethanone |
| SMILES | Cc1cc2onc(C)c2[n+]([O-])c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O3/c1-9-8-12-14(10(2)16-20-12)17(19)13(9)15(18)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | KJTUNJJWBRFXPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|