C26H21NO5S — CID 108587263
(4Z)-1-(1,3-benzodioxol-5-yl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108587263) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is (4Z)-1-(1,3-benzodioxol-5-yl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1,3-benzodioxol-5-yl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108587263 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (4Z)-1-(1,3-benzodioxol-5-yl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc3c(c2)OCO3)C(c2cccs2)/C1=C(/O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H21NO5S/c28-24(17-8-7-15-4-1-2-5-16(15)12-17)22-23(21-6-3-11-33-21)27(26(30)25(22)29)18-9-10-19-20(13-18)32-14-31-19/h3,6-13,23,28H,1-2,4-5,14H2/b24-22- |
| InChIKey | MDLDQVFAVSRRTR-GYHWCHFESA-N |
| XLogP | 4.98 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|