C27H26ClNO4S — CID 108587418
(4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-1-(3-chloro-2-methylphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108587418) has the molecular formula C27H26ClNO4S and a molecular weight of 496.03 g/mol. Its IUPAC name is (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-1-(3-chloro-2-methylphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-1-(3-chloro-2-methylphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108587418 |
| Molecular Formula | C27H26ClNO4S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-1-(3-chloro-2-methylphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(c3cccc(Cl)c3C)C2c2cccs2)cc1C(C)(C)C |
| InChI | InChI=1S/C27H26ClNO4S/c1-15-18(28)8-6-9-19(15)29-23(21-10-7-13-34-21)22(25(31)26(29)32)24(30)16-11-12-20(33-5)17(14-16)27(2,3)4/h6-14,23,30H,1-5H3/b24-22- |
| InChIKey | JRNIJFMZLVYUGX-GYHWCHFESA-N |
| XLogP | 6.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|