C16H23NO3 — CID 10858788
(1S,5R)-1-(3,6-dihydro-2H-pyridine-1-carbonyl)-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one (PubChem CID 10858788) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (1S,5R)-1-(3,6-dihydro-2H-pyridine-1-carbonyl)-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,5R)-1-(3,6-dihydro-2H-pyridine-1-carbonyl)-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 10858788 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1S,5R)-1-(3,6-dihydro-2H-pyridine-1-carbonyl)-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)N1CC=CCC1)C(=O)OC2 |
| InChI | InChI=1S/C16H23NO3/c1-14(2)15(3)7-8-16(14,13(19)20-11-15)12(18)17-9-5-4-6-10-17/h4-5H,6-11H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | LIKIBFBKXDHFJY-HOTGVXAUSA-N |
| XLogP | 2.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|