C25H15Cl2NO3S — CID 108587889
(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-naphthalen-1-yl-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108587889) has the molecular formula C25H15Cl2NO3S and a molecular weight of 480.37 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-naphthalen-1-yl-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-naphthalen-1-yl-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108587889 |
| Molecular Formula | C25H15Cl2NO3S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-naphthalen-1-yl-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc3ccccc23)C(c2cccs2)/C1=C(/O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H15Cl2NO3S/c26-17-11-10-15(13-18(17)27)23(29)21-22(20-9-4-12-32-20)28(25(31)24(21)30)19-8-3-6-14-5-1-2-7-16(14)19/h1-13,22,29H/b23-21- |
| InChIKey | POFFPDQNXKNIQF-LNVKXUELSA-N |
| XLogP | 6.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|