C21H13BrClNO4S — CID 108588140
(4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108588140) has the molecular formula C21H13BrClNO4S and a molecular weight of 490.76 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108588140 |
| Molecular Formula | C21H13BrClNO4S |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 488.94 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(Cl)ccc2O)C(c2cccs2)/C1=C(/O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H13BrClNO4S/c22-12-5-3-11(4-6-12)19(26)17-18(16-2-1-9-29-16)24(21(28)20(17)27)14-10-13(23)7-8-15(14)25/h1-10,18,25-26H/b19-17- |
| InChIKey | QXPSJWCDOLHUND-ZPHPHTNESA-N |
| XLogP | 5.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|