C16H17N5 — CID 10858852
2,6-diethyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium (PubChem CID 10858852) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2,6-diethyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium.
| Compound Name | 2,6-diethyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 10858852 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2,6-diethyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1-c1nnn[n-]1 |
| InChI | InChI=1S/C16H17N5/c1-3-14-10-13(12-8-6-5-7-9-12)11-15(4-2)21(14)16-17-19-20-18-16/h5-11H,3-4H2,1-2H3 |
| InChIKey | CETJHKIAWVXSNA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|