C28H35NO7 — CID 108588741
(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-[4-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108588741) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-[4-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-[4-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108588741 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-[4-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(CCOC)C2c2ccc(OCC(C)C)cc2)c(OCC)c1 |
| InChI | InChI=1S/C28H35NO7/c1-6-34-21-12-13-22(23(16-21)35-7-2)26(30)24-25(29(14-15-33-5)28(32)27(24)31)19-8-10-20(11-9-19)36-17-18(3)4/h8-13,16,18,25,30H,6-7,14-15,17H2,1-5H3/b26-24- |
| InChIKey | GICUWHYHGGBCKA-LCUIJRPUSA-N |
| XLogP | 4.59 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|