About [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate
[1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate (PubChem CID 10859051) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate |
| PubChem CID | 10859051 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC2N(C)C |
| InChI | InChI=1S/C14H20N2O2/c1-15(2)12-9-8-11-10(12)6-5-7-13(11)18-14(17)16(3)4/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | SPYQRYLMKRNKFD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The IUPAC name of [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate (CID 10859051) is [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The canonical SMILES for [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate is CN(C)C(=O)Oc1cccc2c1CCC2N(C)C.
What is the InChIKey of [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The InChIKey is SPYQRYLMKRNKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-15(2)12-9-8-11-10(12)6-5-7-13(11)18-14(17)16(3)4/h5-7,12H,8-9H2,1-4H3.
What are the key properties of [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
[1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate has a molecular weight of 248.33 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(dimethylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 10859051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).