C23H15N5O5 — CID 108590575
(4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108590575) has the molecular formula C23H15N5O5 and a molecular weight of 441.40 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108590575 |
| Molecular Formula | C23H15N5O5 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccccc3[nH]2)C(c2ccccn2)/C1=C(\O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N5O5/c29-20(13-8-10-14(11-9-13)28(32)33)18-19(17-7-3-4-12-24-17)27(22(31)21(18)30)23-25-15-5-1-2-6-16(15)26-23/h1-12,19,29H,(H,25,26)/b20-18+ |
| InChIKey | AIMISQCSAJHMKA-CZIZESTLSA-N |
| XLogP | 3.49 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|