About [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane
[1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane (PubChem CID 10859111) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane |
| PubChem CID | 10859111 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane |
| SMILES | C=C1CCCCC1(CCC(OC)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-13-9-7-8-11-15(13,18-19(4,5)6)12-10-14(16-2)17-3/h14H,1,7-12H2,2-6H3 |
| InChIKey | WJPNZKXXDZSFGS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane?
The IUPAC name of [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane (CID 10859111) is [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane.
What is the SMILES notation for [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane?
The canonical SMILES for [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane is C=C1CCCCC1(CCC(OC)OC)O[Si](C)(C)C.
What is the InChIKey of [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane?
The InChIKey is WJPNZKXXDZSFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-13-9-7-8-11-15(13,18-19(4,5)6)12-10-14(16-2)17-3/h14H,1,7-12H2,2-6H3.
What are the key properties of [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane?
[1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane has a molecular weight of 286.49 g/mol, XLogP of 4.11, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,3-dimethoxypropyl)-2-methylidenecyclohexyl]oxy-trimethylsilane is sourced from PubChem (CID 10859111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).