C24H17ClN4O4 — CID 108592591
(4E)-1-(1H-benzimidazol-2-yl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108592591) has the molecular formula C24H17ClN4O4 and a molecular weight of 460.88 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108592591 |
| Molecular Formula | C24H17ClN4O4 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3nc4ccccc4[nH]3)C2c2cccnc2)c1 |
| InChI | InChI=1S/C24H17ClN4O4/c1-33-14-8-9-16(25)15(11-14)21(30)19-20(13-5-4-10-26-12-13)29(23(32)22(19)31)24-27-17-6-2-3-7-18(17)28-24/h2-12,20,30H,1H3,(H,27,28)/b21-19+ |
| InChIKey | IROUPRQXTUGFAN-XUTLUUPISA-N |
| XLogP | 4.25 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|