About 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine
1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine (PubChem CID 10859364) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine.
Molecular Properties
| Compound Name | 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| PubChem CID | 10859364 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| SMILES | CS(=O)(=O)N1CCC2(CC1)N=C(N)c1ccccc1N2 |
| InChI | InChI=1S/C13H18N4O2S/c1-20(18,19)17-8-6-13(7-9-17)15-11-5-3-2-4-10(11)12(14)16-13/h2-5,15H,6-9H2,1H3,(H2,14,16) |
| InChIKey | ICXFAHOEALHNMX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The IUPAC name of 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine (CID 10859364) is 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine.
What is the SMILES notation for 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The canonical SMILES for 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine is CS(=O)(=O)N1CCC2(CC1)N=C(N)c1ccccc1N2.
What is the InChIKey of 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The InChIKey is ICXFAHOEALHNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-20(18,19)17-8-6-13(7-9-17)15-11-5-3-2-4-10(11)12(14)16-13/h2-5,15H,6-9H2,1H3,(H2,14,16).
What are the key properties of 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine?
1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine has a molecular weight of 294.38 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylsulfonylspiro[1H-quinazoline-2,4'-piperidine]-4-amine is sourced from PubChem (CID 10859364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).