C16H16N4O2 — CID 10859420
4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 10859420) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 10859420 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | COc1ccc(-c2cn3c(=O)[nH]c4c(c3n2)CNCC4)cc1 |
| InChI | InChI=1S/C16H16N4O2/c1-22-11-4-2-10(3-5-11)14-9-20-15(18-14)12-8-17-7-6-13(12)19-16(20)21/h2-5,9,17H,6-8H2,1H3,(H,19,21) |
| InChIKey | ISSPLDULAZVFRB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |