C13H14N8O — CID 10859484
12-N-ethyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene-7,12-diamine (PubChem CID 10859484) has the molecular formula C13H14N8O and a molecular weight of 298.31 g/mol. Its IUPAC name is 12-N-ethyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene-7,12-diamine.
| Compound Name | 12-N-ethyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene-7,12-diamine |
|---|---|
| PubChem CID | 10859484 |
| Molecular Formula | C13H14N8O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 12-N-ethyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene-7,12-diamine |
| SMILES | CCNc1c2c(nc(N)n3nc(-c4ccco4)nc23)nn1C |
| InChI | InChI=1S/C13H14N8O/c1-3-15-11-8-10(18-20(11)2)17-13(14)21-12(8)16-9(19-21)7-5-4-6-22-7/h4-6,15H,3H2,1-2H3,(H2,14,17,18) |
| InChIKey | RUQBAFIWHCWACH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |