C24H19Cl2NO5 — CID 108595258
(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108595258) has the molecular formula C24H19Cl2NO5 and a molecular weight of 472.32 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108595258 |
| Molecular Formula | C24H19Cl2NO5 |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C2/C(=C(/O)c3ccc(Cl)c(Cl)c3)C(=O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H19Cl2NO5/c1-2-31-16-8-5-14(6-9-16)21-20(22(28)15-7-10-18(25)19(26)12-15)23(29)24(30)27(21)13-17-4-3-11-32-17/h3-12,21,28H,2,13H2,1H3/b22-20- |
| InChIKey | IOSZUBIJNDMMRM-XDOYNYLZSA-N |
| XLogP | 5.61 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|