C26H31ClN2O5 — CID 108596619
(4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108596619) has the molecular formula C26H31ClN2O5 and a molecular weight of 487.00 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108596619 |
| Molecular Formula | C26H31ClN2O5 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C2/C(=C(\O)c3cc(OCC)ccc3Cl)C(=O)C(=O)N2CCCN(C)C)c1 |
| InChI | InChI=1S/C26H31ClN2O5/c1-5-33-18-10-7-9-17(15-18)23-22(25(31)26(32)29(23)14-8-13-28(3)4)24(30)20-16-19(34-6-2)11-12-21(20)27/h7,9-12,15-16,23,30H,5-6,8,13-14H2,1-4H3/b24-22+ |
| InChIKey | NTZBXESEXCEFJX-ZNTNEXAZSA-N |
| XLogP | 4.51 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|