C24H20ClNO6 — CID 108596914
(4E)-5-(3-chloro-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108596914) has the molecular formula C24H20ClNO6 and a molecular weight of 453.88 g/mol. Its IUPAC name is (4E)-5-(3-chloro-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108596914 |
| Molecular Formula | C24H20ClNO6 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C)cc1/C(O)=C1\C(=O)C(=O)N(Cc2ccco2)C1c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClNO6/c1-13-5-8-19(31-2)16(10-13)22(28)20-21(14-6-7-18(27)17(25)11-14)26(24(30)23(20)29)12-15-4-3-9-32-15/h3-11,21,27-28H,12H2,1-2H3/b22-20+ |
| InChIKey | VGYNOLCXDDQYCQ-LSDHQDQOSA-N |
| XLogP | 4.58 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|