C20H32O2 — CID 10859692
(3aR,3bR,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-1-one (PubChem CID 10859692) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3aR,3bR,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3aR,3bR,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 10859692 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3aR,3bR,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-1-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC[C@H]4C(=O)OC[C@H]4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-18(2)9-5-10-20(4)15(18)8-11-19(3)14-12-22-17(21)13(14)6-7-16(19)20/h13-16H,5-12H2,1-4H3/t13-,14-,15+,16+,19+,20+/m1/s1 |
| InChIKey | WCUOOFAOAONCLX-JGCABRRYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |