C28H32ClNO5 — CID 108596967
(4E)-5-(3-chloro-4-hydroxyphenyl)-1-cyclohexyl-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108596967) has the molecular formula C28H32ClNO5 and a molecular weight of 498.02 g/mol. Its IUPAC name is (4E)-5-(3-chloro-4-hydroxyphenyl)-1-cyclohexyl-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-1-cyclohexyl-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108596967 |
| Molecular Formula | C28H32ClNO5 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-1-cyclohexyl-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1cc(C)c(/C(O)=C2\C(=O)C(=O)N(C3CCCCC3)C2c2ccc(O)c(Cl)c2)cc1C(C)C |
| InChI | InChI=1S/C28H32ClNO5/c1-15(2)19-14-20(16(3)12-23(19)35-4)26(32)24-25(17-10-11-22(31)21(29)13-17)30(28(34)27(24)33)18-8-6-5-7-9-18/h10-15,18,25,31-32H,5-9H2,1-4H3/b26-24+ |
| InChIKey | WGCOBDPCZMYAMJ-SHHOIMCASA-N |
| XLogP | 6.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|