C17H28N2O3 — CID 10859812
6,6-dimethoxy-5,5-dimethyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)hexan-1-one (PubChem CID 10859812) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 6,6-dimethoxy-5,5-dimethyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)hexan-1-one.
| Compound Name | 6,6-dimethoxy-5,5-dimethyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 10859812 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 6,6-dimethoxy-5,5-dimethyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)hexan-1-one |
| SMILES | COC(OC)C(C)(C)CCCC(=O)c1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C17H28N2O3/c1-17(2,16(21-3)22-4)10-7-8-14(20)13-12-19-11-6-5-9-15(19)18-13/h12,16H,5-11H2,1-4H3 |
| InChIKey | KGUAFJDDRLICQX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|