About (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol
(3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol (PubChem CID 10859815) has the molecular formula C13H24O4S2
and a molecular weight of 308.47 g/mol. Its IUPAC name is (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol.
Molecular Properties
| Compound Name | (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol |
| PubChem CID | 10859815 |
| Molecular Formula | C13H24O4S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol |
| SMILES | COCO[C@@H]1CCSC[C@@H]1[C@@H](O)[C@H]1CSCC[C@H]1O |
| InChI | InChI=1S/C13H24O4S2/c1-16-8-17-12-3-5-19-7-10(12)13(15)9-6-18-4-2-11(9)14/h9-15H,2-8H2,1H3/t9-,10-,11+,12+,13-/m0/s1 |
| InChIKey | FHQGVTUMHDGTMD-YYHQMBLXSA-N |
| XLogP | 1.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol?
The IUPAC name of (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol (CID 10859815) is (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol.
What is the SMILES notation for (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol?
The canonical SMILES for (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol is COCO[C@@H]1CCSC[C@@H]1[C@@H](O)[C@H]1CSCC[C@H]1O.
What is the InChIKey of (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol?
The InChIKey is FHQGVTUMHDGTMD-YYHQMBLXSA-N. The full InChI is InChI=1S/C13H24O4S2/c1-16-8-17-12-3-5-19-7-10(12)13(15)9-6-18-4-2-11(9)14/h9-15H,2-8H2,1H3/t9-,10-,11+,12+,13-/m0/s1.
What are the key properties of (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol?
(3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol has a molecular weight of 308.47 g/mol, XLogP of 1.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-[(S)-hydroxy-[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methyl]thian-4-ol is sourced from PubChem (CID 10859815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).