C27H19NO6 — CID 108598620
methyl 3-[3-(1-benzofuran-2-carbonyl)-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]benzoate (PubChem CID 108598620) has the molecular formula C27H19NO6 and a molecular weight of 453.45 g/mol. Its IUPAC name is methyl 3-[3-(1-benzofuran-2-carbonyl)-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[3-(1-benzofuran-2-carbonyl)-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 108598620 |
| Molecular Formula | C27H19NO6 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | methyl 3-[3-(1-benzofuran-2-carbonyl)-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(O)=C(C(=O)c3cc4ccccc4o3)C2c2ccccc2)c1 |
| InChI | InChI=1S/C27H19NO6/c1-33-27(32)18-11-7-12-19(14-18)28-23(16-8-3-2-4-9-16)22(25(30)26(28)31)24(29)21-15-17-10-5-6-13-20(17)34-21/h2-15,23,30H,1H3 |
| InChIKey | SYWFVFOPSCGIPD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |