C26H21FN2O5 — CID 108599093
N-[4-[(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108599093) has the molecular formula C26H21FN2O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[4-[(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108599093 |
| Molecular Formula | C26H21FN2O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[4-[(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(F)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(NC(C)=O)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C26H21FN2O5/c1-15(30)28-18-9-11-19(12-10-18)29-23(16-6-4-3-5-7-16)22(25(32)26(29)33)24(31)20-14-17(27)8-13-21(20)34-2/h3-14,23,31H,1-2H3,(H,28,30)/b24-22+ |
| InChIKey | JAPHFRBBOOSXMS-ZNTNEXAZSA-N |
| XLogP | 4.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|