C22H22FNO3 — CID 108599499
1-[2-(4-fluorophenyl)ethyl]-4-hydroxy-3-(2-methylpropanoyl)-2-phenyl-2H-pyrrol-5-one (PubChem CID 108599499) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-4-hydroxy-3-(2-methylpropanoyl)-2-phenyl-2H-pyrrol-5-one.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-4-hydroxy-3-(2-methylpropanoyl)-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108599499 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-4-hydroxy-3-(2-methylpropanoyl)-2-phenyl-2H-pyrrol-5-one |
| SMILES | CC(C)C(=O)C1=C(O)C(=O)N(CCc2ccc(F)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H22FNO3/c1-14(2)20(25)18-19(16-6-4-3-5-7-16)24(22(27)21(18)26)13-12-15-8-10-17(23)11-9-15/h3-11,14,19,26H,12-13H2,1-2H3 |
| InChIKey | FCHZQBGPPVRICH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |