C21H21ClN2O3 — CID 108600273
2-(4-chlorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-(pyridin-2-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108600273) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-(pyridin-2-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-(pyridin-2-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108600273 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(4-chlorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-(pyridin-2-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CC(C)CC(=O)C1=C(O)C(=O)N(Cc2ccccn2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-13(2)11-17(25)18-19(14-6-8-15(22)9-7-14)24(21(27)20(18)26)12-16-5-3-4-10-23-16/h3-10,13,19,26H,11-12H2,1-2H3 |
| InChIKey | KDPFOWXRJCFCFA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |