C21H15ClN2O4 — CID 108600418
2-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108600418) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108600418 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(Cc2ccncc2)C1c1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C21H15ClN2O4/c22-15-5-3-14(4-6-15)18-17(19(25)16-2-1-11-28-16)20(26)21(27)24(18)12-13-7-9-23-10-8-13/h1-11,18,26H,12H2 |
| InChIKey | VCCQODBMFGZLGJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |