C18H22O5 — CID 10860105
(2R,4aR,6S,8S,8aS)-6-methoxy-8-methyl-2-phenyl-8-prop-2-enyl-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-7-one (PubChem CID 10860105) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R,4aR,6S,8S,8aS)-6-methoxy-8-methyl-2-phenyl-8-prop-2-enyl-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-7-one.
| Compound Name | (2R,4aR,6S,8S,8aS)-6-methoxy-8-methyl-2-phenyl-8-prop-2-enyl-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-7-one |
|---|---|
| PubChem CID | 10860105 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (2R,4aR,6S,8S,8aS)-6-methoxy-8-methyl-2-phenyl-8-prop-2-enyl-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-7-one |
| SMILES | C=CC[C@]1(C)C(=O)[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C18H22O5/c1-4-10-18(2)14(19)17(20-3)22-13-11-21-16(23-15(13)18)12-8-6-5-7-9-12/h4-9,13,15-17H,1,10-11H2,2-3H3/t13-,15-,16-,17+,18-/m1/s1 |
| InChIKey | JHOCHAVXTPPOSC-FXXCCUJSSA-N |
| XLogP | 2.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|