C19H26O4 — CID 10860110
(1R,8S)-3,6-dimethoxy-4,5-di(propan-2-yloxy)tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 10860110) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (1R,8S)-3,6-dimethoxy-4,5-di(propan-2-yloxy)tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | (1R,8S)-3,6-dimethoxy-4,5-di(propan-2-yloxy)tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 10860110 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (1R,8S)-3,6-dimethoxy-4,5-di(propan-2-yloxy)tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | COc1c(OC(C)C)c(OC(C)C)c(OC)c2c1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H26O4/c1-10(2)22-18-16(20-5)14-12-7-8-13(9-12)15(14)17(21-6)19(18)23-11(3)4/h7-8,10-13H,9H2,1-6H3/t12-,13+ |
| InChIKey | QOOGKTNNWHIKJO-BETUJISGSA-N |
| XLogP | 4.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|