C28H24F3NO4 — CID 108601435
(4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 108601435) has the molecular formula C28H24F3NO4 and a molecular weight of 495.50 g/mol. Its IUPAC name is (4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108601435 |
| Molecular Formula | C28H24F3NO4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(C)(C)C)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(F)cc2F)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H24F3NO4/c1-28(2,3)16-7-12-22(36-4)19(13-16)25(33)23-24(15-5-8-17(29)9-6-15)32(27(35)26(23)34)21-11-10-18(30)14-20(21)31/h5-14,24,33H,1-4H3/b25-23+ |
| InChIKey | WPMOYFAWNRLXJH-WJTDDFOZSA-N |
| XLogP | 6.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|