C26H20F3NO4 — CID 108601481
(4E)-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108601481) has the molecular formula C26H20F3NO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is (4E)-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108601481 |
| Molecular Formula | C26H20F3NO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (4E)-1-(2,4-difluorophenyl)-5-(4-fluorophenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(F)cc3F)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H20F3NO4/c1-14(2)34-19-10-5-16(6-11-19)24(31)22-23(15-3-7-17(27)8-4-15)30(26(33)25(22)32)21-12-9-18(28)13-20(21)29/h3-14,23,31H,1-2H3/b24-22+ |
| InChIKey | HHNFBRLFTDCDDT-ZNTNEXAZSA-N |
| XLogP | 5.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|