About ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate
ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate (PubChem CID 10860175) has the molecular formula C11H20F3O5P
and a molecular weight of 320.24 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate.
Molecular Properties
| Compound Name | ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate |
| PubChem CID | 10860175 |
| Molecular Formula | C11H20F3O5P |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate |
| SMILES | CCOC(=O)C(C(F)(F)F)=P(OCC)(OCC)OCC |
| InChI | InChI=1S/C11H20F3O5P/c1-5-16-10(15)9(11(12,13)14)20(17-6-2,18-7-3)19-8-4/h5-8H2,1-4H3 |
| InChIKey | IPGGDVFRPKHDRM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate?
The IUPAC name of ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate (CID 10860175) is ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate.
What is the SMILES notation for ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate?
The canonical SMILES for ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate is CCOC(=O)C(C(F)(F)F)=P(OCC)(OCC)OCC.
What is the InChIKey of ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate?
The InChIKey is IPGGDVFRPKHDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3O5P/c1-5-16-10(15)9(11(12,13)14)20(17-6-2,18-7-3)19-8-4/h5-8H2,1-4H3.
What are the key properties of ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate?
ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate has a molecular weight of 320.24 g/mol, XLogP of 3.16, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3,3-trifluoro-2-(triethoxy-λ5-phosphanylidene)propanoate is sourced from PubChem (CID 10860175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).