C17H23NO5 — CID 10860207
(2R,5R,6R)-2-tert-butyl-6-methyl-5-[(1S)-2-nitro-1-phenylethyl]-1,3-dioxan-4-one (PubChem CID 10860207) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is (2R,5R,6R)-2-tert-butyl-6-methyl-5-[(1S)-2-nitro-1-phenylethyl]-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-2-tert-butyl-6-methyl-5-[(1S)-2-nitro-1-phenylethyl]-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10860207 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2R,5R,6R)-2-tert-butyl-6-methyl-5-[(1S)-2-nitro-1-phenylethyl]-1,3-dioxan-4-one |
| SMILES | C[C@H]1O[C@@H](C(C)(C)C)OC(=O)[C@@H]1[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H23NO5/c1-11-14(15(19)23-16(22-11)17(2,3)4)13(10-18(20)21)12-8-6-5-7-9-12/h5-9,11,13-14,16H,10H2,1-4H3/t11-,13-,14+,16-/m1/s1 |
| InChIKey | SFCMEDUPKMBTPZ-OEYIWLLWSA-N |
| XLogP | 3.00 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|