C18H30O3Si — CID 10860254
(3S,3aS,5aS,8S,9S,9aS,9bR)-3,5a,9-trimethyl-8-trimethylsilyloxy-3,3a,4,5,8,9,9a,9b-octahydrobenzo[g][1]benzofuran-2-one (PubChem CID 10860254) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (3S,3aS,5aS,8S,9S,9aS,9bR)-3,5a,9-trimethyl-8-trimethylsilyloxy-3,3a,4,5,8,9,9a,9b-octahydrobenzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,5aS,8S,9S,9aS,9bR)-3,5a,9-trimethyl-8-trimethylsilyloxy-3,3a,4,5,8,9,9a,9b-octahydrobenzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 10860254 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3S,3aS,5aS,8S,9S,9aS,9bR)-3,5a,9-trimethyl-8-trimethylsilyloxy-3,3a,4,5,8,9,9a,9b-octahydrobenzo[g][1]benzofuran-2-one |
| SMILES | C[C@H]1[C@@H]2[C@@H]3OC(=O)[C@@H](C)[C@@H]3CC[C@@]2(C)C=C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H30O3Si/c1-11-13-7-9-18(3)10-8-14(21-22(4,5)6)12(2)15(18)16(13)20-17(11)19/h8,10-16H,7,9H2,1-6H3/t11-,12+,13-,14-,15+,16+,18-/m0/s1 |
| InChIKey | KFUPNXHMEQEXRA-NPPSCGBJSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|