C18H32O5 — CID 10860446
(3S,4R)-3,4-bis(hex-5-enoxy)-2,5-dimethoxyoxolane (PubChem CID 10860446) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3S,4R)-3,4-bis(hex-5-enoxy)-2,5-dimethoxyoxolane.
| Compound Name | (3S,4R)-3,4-bis(hex-5-enoxy)-2,5-dimethoxyoxolane |
|---|---|
| PubChem CID | 10860446 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3S,4R)-3,4-bis(hex-5-enoxy)-2,5-dimethoxyoxolane |
| SMILES | C=CCCCCO[C@@H]1C(OC)OC(OC)[C@@H]1OCCCCC=C |
| InChI | InChI=1S/C18H32O5/c1-5-7-9-11-13-21-15-16(22-14-12-10-8-6-2)18(20-4)23-17(15)19-3/h5-6,15-18H,1-2,7-14H2,3-4H3/t15-,16+,17?,18? |
| InChIKey | MEMLAEUODWERCS-OQSMONGASA-N |
| XLogP | 3.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|