C17H19NO4S — CID 10860575
ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-ynoate (PubChem CID 10860575) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-ynoate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 10860575 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-ynoate |
| SMILES | C#CCC(C(=O)OCC)N(CC#C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-5-8-16(17(19)22-7-3)18(13-6-2)23(20,21)15-11-9-14(4)10-12-15/h1-2,9-12,16H,7-8,13H2,3-4H3 |
| InChIKey | DFPYNVYMWZLFPP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|