C26H27Cl2N3O5 — CID 108605979
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108605979) has the molecular formula C26H27Cl2N3O5 and a molecular weight of 532.42 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108605979 |
| Molecular Formula | C26H27Cl2N3O5 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2cn(C)c3ccccc23)c(OC)c1Cl |
| InChI | InChI=1S/C26H27Cl2N3O5/c1-29(2)10-11-31-21(16-13-30(3)18-9-7-6-8-14(16)18)19(23(33)26(31)34)22(32)15-12-17(27)25(36-5)20(28)24(15)35-4/h6-9,12-13,21,32H,10-11H2,1-5H3/b22-19+ |
| InChIKey | MJSURCRWHYEZGX-ZBJSNUHESA-N |
| XLogP | 4.49 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|