C29H27F2NO4 — CID 108606441
(4E)-1-(3,4-difluorophenyl)-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108606441) has the molecular formula C29H27F2NO4 and a molecular weight of 491.53 g/mol. Its IUPAC name is (4E)-1-(3,4-difluorophenyl)-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3,4-difluorophenyl)-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108606441 |
| Molecular Formula | C29H27F2NO4 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (4E)-1-(3,4-difluorophenyl)-4-[hydroxy-(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(F)c(F)c3)C2c2ccccc2C)cc1C(C)C |
| InChI | InChI=1S/C29H27F2NO4/c1-15(2)20-14-21(17(4)12-24(20)36-5)27(33)25-26(19-9-7-6-8-16(19)3)32(29(35)28(25)34)18-10-11-22(30)23(31)13-18/h6-15,26,33H,1-5H3/b27-25+ |
| InChIKey | SWMHOGQJZUXXIJ-IMVLJIQESA-N |
| XLogP | 6.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|