C25H21NO8 — CID 108606781
(4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3,5-dimethoxyphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108606781) has the molecular formula C25H21NO8 and a molecular weight of 463.44 g/mol. Its IUPAC name is (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3,5-dimethoxyphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3,5-dimethoxyphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108606781 |
| Molecular Formula | C25H21NO8 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3,5-dimethoxyphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)OCCO4)C2c2ccco2)c1 |
| InChI | InChI=1S/C25H21NO8/c1-30-16-11-15(12-17(13-16)31-2)26-22(19-4-3-7-32-19)21(24(28)25(26)29)23(27)14-5-6-18-20(10-14)34-9-8-33-18/h3-7,10-13,22,27H,8-9H2,1-2H3/b23-21- |
| InChIKey | OCWLZKHHSKUDMO-LNVKXUELSA-N |
| XLogP | 3.69 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|