About (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine
(2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine (PubChem CID 10860732) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine.
Molecular Properties
| Compound Name | (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine |
| PubChem CID | 10860732 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine |
| SMILES | CC1(C)OC[C@@H]([C@H](/C=N/Cc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2)24-16-20(25-21)19(23-15-18-11-7-4-8-12-18)14-22-13-17-9-5-3-6-10-17/h3-12,14,19-20H,13,15-16H2,1-2H3/b22-14+/t19-,20-/m0/s1 |
| InChIKey | MVEVEEBNMBLBJG-OZGLUBAOSA-N |
| XLogP | 3.99 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine?
The IUPAC name of (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine (CID 10860732) is (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine.
What is the SMILES notation for (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine?
The canonical SMILES for (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine is CC1(C)OC[C@@H]([C@H](/C=N/Cc2ccccc2)OCc2ccccc2)O1.
What is the InChIKey of (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine?
The InChIKey is MVEVEEBNMBLBJG-OZGLUBAOSA-N. The full InChI is InChI=1S/C21H25NO3/c1-21(2)24-16-20(25-21)19(23-15-18-11-7-4-8-12-18)14-22-13-17-9-5-3-6-10-17/h3-12,14,19-20H,13,15-16H2,1-2H3/b22-14+/t19-,20-/m0/s1.
What are the key properties of (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine?
(2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine has a molecular weight of 339.44 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine is sourced from PubChem (CID 10860732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).