C25H22N2O7 — CID 108607743
N-[4-[(3Z)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108607743) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is N-[4-[(3Z)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3Z)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108607743 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[4-[(3Z)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(OC)c(/C(O)=C2/C(=O)C(=O)N(c3ccc(NC(C)=O)cc3)C2c2ccco2)c1 |
| InChI | InChI=1S/C25H22N2O7/c1-14(28)26-15-6-8-16(9-7-15)27-22(20-5-4-12-34-20)21(24(30)25(27)31)23(29)18-13-17(32-2)10-11-19(18)33-3/h4-13,22,29H,1-3H3,(H,26,28)/b23-21- |
| InChIKey | LKVODDDYBWFUTP-LNVKXUELSA-N |
| XLogP | 3.88 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|