C16H24NO3PS — CID 10860780
2-[(2R,4R)-5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 10860780) has the molecular formula C16H24NO3PS and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[(2R,4R)-5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[(2R,4R)-5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10860780 |
| Molecular Formula | C16H24NO3PS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[(2R,4R)-5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)([C@H]2N[C@@H](c3ccccc3)SC2(C)C)OC1 |
| InChI | InChI=1S/C16H24NO3PS/c1-15(2)10-19-21(18,20-11-15)14-16(3,4)22-13(17-14)12-8-6-5-7-9-12/h5-9,13-14,17H,10-11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | OIKSZGLLPHHNLQ-ZIAGYGMSSA-N |
| XLogP | 4.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|