C30H22F3NO5 — CID 108607970
(4Z)-5-(furan-2-yl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108607970) has the molecular formula C30H22F3NO5 and a molecular weight of 533.50 g/mol. Its IUPAC name is (4Z)-5-(furan-2-yl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(furan-2-yl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108607970 |
| Molecular Formula | C30H22F3NO5 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (4Z)-5-(furan-2-yl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C(F)(F)F)cc3)C2c2ccco2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H22F3NO5/c1-18-16-20(9-14-23(18)39-17-19-6-3-2-4-7-19)27(35)25-26(24-8-5-15-38-24)34(29(37)28(25)36)22-12-10-21(11-13-22)30(31,32)33/h2-16,26,35H,17H2,1H3/b27-25- |
| InChIKey | BKIBBKATEVACQB-RFBIWTDZSA-N |
| XLogP | 6.81 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|