C19H38O3Si — CID 10860818
tert-butyl-[(3E)-5,5-dibutoxypenta-1,3-dien-2-yl]oxy-dimethylsilane (PubChem CID 10860818) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is tert-butyl-[(3E)-5,5-dibutoxypenta-1,3-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3E)-5,5-dibutoxypenta-1,3-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10860818 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl-[(3E)-5,5-dibutoxypenta-1,3-dien-2-yl]oxy-dimethylsilane |
| SMILES | C=C(/C=C/C(OCCCC)OCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-9-11-15-20-18(21-16-12-10-2)14-13-17(3)22-23(7,8)19(4,5)6/h13-14,18H,3,9-12,15-16H2,1-2,4-8H3/b14-13+ |
| InChIKey | IRSAMQVULVYGJH-BUHFOSPRSA-N |
| XLogP | 6.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|