C26H24ClNO6 — CID 108608340
(4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[(4-ethoxyphenyl)methyl]-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108608340) has the molecular formula C26H24ClNO6 and a molecular weight of 481.93 g/mol. Its IUPAC name is (4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[(4-ethoxyphenyl)methyl]-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[(4-ethoxyphenyl)methyl]-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108608340 |
| Molecular Formula | C26H24ClNO6 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-1-[(4-ethoxyphenyl)methyl]-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(CN2C(=O)C(=O)/C(=C(\O)c3cc(OCC)ccc3Cl)C2c2ccco2)cc1 |
| InChI | InChI=1S/C26H24ClNO6/c1-3-32-17-9-7-16(8-10-17)15-28-23(21-6-5-13-34-21)22(25(30)26(28)31)24(29)19-14-18(33-4-2)11-12-20(19)27/h5-14,23,29H,3-4,15H2,1-2H3/b24-22- |
| InChIKey | YEQNLUSSKWSVIN-GYHWCHFESA-N |
| XLogP | 5.35 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|