C20H27NO2S — CID 10860899
ethyl 7-[3-(methylamino)-5-phenylthiophen-2-yl]heptanoate (PubChem CID 10860899) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is ethyl 7-[3-(methylamino)-5-phenylthiophen-2-yl]heptanoate.
| Compound Name | ethyl 7-[3-(methylamino)-5-phenylthiophen-2-yl]heptanoate |
|---|---|
| PubChem CID | 10860899 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | ethyl 7-[3-(methylamino)-5-phenylthiophen-2-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCc1sc(-c2ccccc2)cc1NC |
| InChI | InChI=1S/C20H27NO2S/c1-3-23-20(22)14-10-5-4-9-13-18-17(21-2)15-19(24-18)16-11-7-6-8-12-16/h6-8,11-12,15,21H,3-5,9-10,13-14H2,1-2H3 |
| InChIKey | KEBBMFKDOPSGHS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|